C22H22FNO3 — CID 19438921
2-benzoyl-6-(4-fluorophenyl)-6-hydroxy-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-one (PubChem CID 19438921) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-benzoyl-6-(4-fluorophenyl)-6-hydroxy-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-one.
| Compound Name | 2-benzoyl-6-(4-fluorophenyl)-6-hydroxy-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-one |
|---|---|
| PubChem CID | 19438921 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-benzoyl-6-(4-fluorophenyl)-6-hydroxy-4,4a,5,7,8,8a-hexahydro-3H-isoquinolin-1-one |
| SMILES | O=C(c1ccccc1)N1CCC2CC(O)(c3ccc(F)cc3)CCC2C1=O |
| InChI | InChI=1S/C22H22FNO3/c23-18-8-6-17(7-9-18)22(27)12-10-19-16(14-22)11-13-24(21(19)26)20(25)15-4-2-1-3-5-15/h1-9,16,19,27H,10-14H2 |
| InChIKey | AJPMLPAZZQOABY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|