C29H42O13 — CID 70895186
methyl (3S,4S,6R)-6-[(3R,4S)-4-acetyloxy-2-(acetyloxymethyl)-6-hydroxy-5-phenylmethoxyoxan-3-yl]oxy-2-ethyl-4,5-dimethoxy-3-methyloxane-2-carboxylate (PubChem CID 70895186) has the molecular formula C29H42O13 and a molecular weight of 598.64 g/mol. Its IUPAC name is methyl (3S,4S,6R)-6-[(3R,4S)-4-acetyloxy-2-(acetyloxymethyl)-6-hydroxy-5-phenylmethoxyoxan-3-yl]oxy-2-ethyl-4,5-dimethoxy-3-methyloxane-2-carboxylate.
| Compound Name | methyl (3S,4S,6R)-6-[(3R,4S)-4-acetyloxy-2-(acetyloxymethyl)-6-hydroxy-5-phenylmethoxyoxan-3-yl]oxy-2-ethyl-4,5-dimethoxy-3-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 70895186 |
| Molecular Formula | C29H42O13 |
| Molecular Weight | 598.64 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | methyl (3S,4S,6R)-6-[(3R,4S)-4-acetyloxy-2-(acetyloxymethyl)-6-hydroxy-5-phenylmethoxyoxan-3-yl]oxy-2-ethyl-4,5-dimethoxy-3-methyloxane-2-carboxylate |
| SMILES | CCC1(C(=O)OC)O[C@@H](O[C@@H]2C(COC(C)=O)OC(O)C(OCc3ccccc3)[C@H]2OC(C)=O)C(OC)[C@@H](OC)[C@@H]1C |
| InChI | InChI=1S/C29H42O13/c1-8-29(28(33)36-7)16(2)21(34-5)25(35-6)27(42-29)41-22-20(15-37-17(3)30)40-26(32)24(23(22)39-18(4)31)38-14-19-12-10-9-11-13-19/h9-13,16,20-27,32H,8,14-15H2,1-7H3/t16-,20?,21-,22+,23-,24?,25?,26?,27+,29?/m0/s1 |
| InChIKey | RVSUIQQORZPNGC-SGRNEPQUSA-N |
| XLogP | 1.51 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.64 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|