C18H20N2O2 — CID 70895529
8-(2-methoxycyclohexa-1,3-dien-1-yl)-5,6-dihydronaphthalene-2-carbohydrazide (PubChem CID 70895529) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 8-(2-methoxycyclohexa-1,3-dien-1-yl)-5,6-dihydronaphthalene-2-carbohydrazide.
| Compound Name | 8-(2-methoxycyclohexa-1,3-dien-1-yl)-5,6-dihydronaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 70895529 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 8-(2-methoxycyclohexa-1,3-dien-1-yl)-5,6-dihydronaphthalene-2-carbohydrazide |
| SMILES | COC1=C(C2=CCCc3ccc(C(=O)NN)cc32)CCC=C1 |
| InChI | InChI=1S/C18H20N2O2/c1-22-17-8-3-2-6-15(17)14-7-4-5-12-9-10-13(11-16(12)14)18(21)20-19/h3,7-11H,2,4-6,19H2,1H3,(H,20,21) |
| InChIKey | NNRRTUUEEJHRLK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|