C23H27NO8 — CID 70895873
morpholin-4-yl-[4-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone (PubChem CID 70895873) has the molecular formula C23H27NO8 and a molecular weight of 445.47 g/mol. Its IUPAC name is morpholin-4-yl-[4-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone.
| Compound Name | morpholin-4-yl-[4-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone |
|---|---|
| PubChem CID | 70895873 |
| Molecular Formula | C23H27NO8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | morpholin-4-yl-[4-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H27NO8/c25-13-18-19(26)20(27)21(28)23(32-18)31-17-7-5-15(6-8-17)14-1-3-16(4-2-14)22(29)24-9-11-30-12-10-24/h1-8,18-21,23,25-28H,9-13H2/t18-,19-,20+,21+,23+/m1/s1 |
| InChIKey | KXOHNGPGIAFVME-RBRWEJTLSA-N |
| XLogP | 0.00 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |