C15H13F3N2O4S — CID 70896464
1-[5-(difluoromethylsulfonyl)-2-methoxyphenyl]-1-(4-fluorophenyl)urea (PubChem CID 70896464) has the molecular formula C15H13F3N2O4S and a molecular weight of 374.34 g/mol. Its IUPAC name is 1-[5-(difluoromethylsulfonyl)-2-methoxyphenyl]-1-(4-fluorophenyl)urea.
| Compound Name | 1-[5-(difluoromethylsulfonyl)-2-methoxyphenyl]-1-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 70896464 |
| Molecular Formula | C15H13F3N2O4S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 1-[5-(difluoromethylsulfonyl)-2-methoxyphenyl]-1-(4-fluorophenyl)urea |
| SMILES | COc1ccc(S(=O)(=O)C(F)F)cc1N(C(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13F3N2O4S/c1-24-13-7-6-11(25(22,23)14(17)18)8-12(13)20(15(19)21)10-4-2-9(16)3-5-10/h2-8,14H,1H3,(H2,19,21) |
| InChIKey | SZAPRTGMLJQFII-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |