C10H15NO2S2 — CID 70914818
methyl 4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]butanoate (PubChem CID 70914818) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is methyl 4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]butanoate.
| Compound Name | methyl 4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 70914818 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | methyl 4-[(4,5-dimethyl-1,3-thiazol-2-yl)sulfanyl]butanoate |
| SMILES | COC(=O)CCCSc1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H15NO2S2/c1-7-8(2)15-10(11-7)14-6-4-5-9(12)13-3/h4-6H2,1-3H3 |
| InChIKey | ZQYRQZXJAMAZLO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|