C26H24ClN5O3S — CID 70933736
6-(4-acetylpiperazin-1-yl)-N-(4-chloro-3-isoquinolin-1-ylphenyl)pyridine-3-sulfonamide (PubChem CID 70933736) has the molecular formula C26H24ClN5O3S and a molecular weight of 522.03 g/mol. Its IUPAC name is 6-(4-acetylpiperazin-1-yl)-N-(4-chloro-3-isoquinolin-1-ylphenyl)pyridine-3-sulfonamide.
| Compound Name | 6-(4-acetylpiperazin-1-yl)-N-(4-chloro-3-isoquinolin-1-ylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 70933736 |
| Molecular Formula | C26H24ClN5O3S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 6-(4-acetylpiperazin-1-yl)-N-(4-chloro-3-isoquinolin-1-ylphenyl)pyridine-3-sulfonamide |
| SMILES | CC(=O)N1CCN(c2ccc(S(=O)(=O)Nc3ccc(Cl)c(-c4nccc5ccccc45)c3)cn2)CC1 |
| InChI | InChI=1S/C26H24ClN5O3S/c1-18(33)31-12-14-32(15-13-31)25-9-7-21(17-29-25)36(34,35)30-20-6-8-24(27)23(16-20)26-22-5-3-2-4-19(22)10-11-28-26/h2-11,16-17,30H,12-15H2,1H3 |
| InChIKey | UHJYSQBAKBZFQV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |