C24H22ClN5O2S — CID 70933734
N-(4-chloro-3-isoquinolin-1-ylphenyl)-6-piperazin-1-ylpyridine-3-sulfonamide (PubChem CID 70933734) has the molecular formula C24H22ClN5O2S and a molecular weight of 479.99 g/mol. Its IUPAC name is N-(4-chloro-3-isoquinolin-1-ylphenyl)-6-piperazin-1-ylpyridine-3-sulfonamide.
| Compound Name | N-(4-chloro-3-isoquinolin-1-ylphenyl)-6-piperazin-1-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 70933734 |
| Molecular Formula | C24H22ClN5O2S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-(4-chloro-3-isoquinolin-1-ylphenyl)-6-piperazin-1-ylpyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Cl)c(-c2nccc3ccccc23)c1)c1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C24H22ClN5O2S/c25-22-7-5-18(15-21(22)24-20-4-2-1-3-17(20)9-10-27-24)29-33(31,32)19-6-8-23(28-16-19)30-13-11-26-12-14-30/h1-10,15-16,26,29H,11-14H2 |
| InChIKey | RWLGMVUJRXHOPR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |