C21H27N4+ — CID 7093420
(4aS,8aR,9aS,10aS)-10-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile (PubChem CID 7093420) has the molecular formula C21H27N4+ and a molecular weight of 335.47 g/mol. Its IUPAC name is (4aS,8aR,9aS,10aS)-10-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile.
| Compound Name | (4aS,8aR,9aS,10aS)-10-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile |
|---|---|
| PubChem CID | 7093420 |
| Molecular Formula | C21H27N4+ |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (4aS,8aR,9aS,10aS)-10-(pyridin-2-ylmethyl)-1,2,3,4,5,6,7,8,8a,9,9a,10-dodecahydroacridin-10-ium-4a,10a-dicarbonitrile |
| SMILES | N#C[C@]12CCCC[C@@H]1C[C@@H]1CCCC[C@]1(C#N)[NH+]2Cc1ccccn1 |
| InChI | InChI=1S/C21H26N4/c22-15-20-10-4-1-7-17(20)13-18-8-2-5-11-21(18,16-23)25(20)14-19-9-3-6-12-24-19/h3,6,9,12,17-18H,1-2,4-5,7-8,10-11,13-14H2/p+1/t17-,18+,20-,21-/m1/s1 |
| InChIKey | CBZQHICWBVVOJL-KOUHRCEDSA-O |
| XLogP | 2.78 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |