C23H32F4O8 — CID 70936439
bis(1-ethoxy-2,2-difluoro-1-oxopentan-3-yl) bicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 70936439) has the molecular formula C23H32F4O8 and a molecular weight of 512.49 g/mol. Its IUPAC name is bis(1-ethoxy-2,2-difluoro-1-oxopentan-3-yl) bicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | bis(1-ethoxy-2,2-difluoro-1-oxopentan-3-yl) bicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 70936439 |
| Molecular Formula | C23H32F4O8 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | bis(1-ethoxy-2,2-difluoro-1-oxopentan-3-yl) bicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)C(F)(F)C(CC)OC(=O)C1C2CCC(C2)C1C(=O)OC(CC)C(F)(F)C(=O)OCC |
| InChI | InChI=1S/C23H32F4O8/c1-5-14(22(24,25)20(30)32-7-3)34-18(28)16-12-9-10-13(11-12)17(16)19(29)35-15(6-2)23(26,27)21(31)33-8-4/h12-17H,5-11H2,1-4H3 |
| InChIKey | JIGBRBYENLMZCQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|