C22H37N2O2+ — CID 7094230
dimethyl-[3-[[2-[(2S,4R)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl]azanium (PubChem CID 7094230) has the molecular formula C22H37N2O2+ and a molecular weight of 361.55 g/mol. Its IUPAC name is dimethyl-[3-[[2-[(2S,4R)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl]azanium.
| Compound Name | dimethyl-[3-[[2-[(2S,4R)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 7094230 |
| Molecular Formula | C22H37N2O2+ |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | dimethyl-[3-[[2-[(2S,4R)-4-(4-methylphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl]azanium |
| SMILES | Cc1ccc([C@]2(CC(=O)NCCC[NH+](C)C)CCO[C@H](C(C)C)C2)cc1 |
| InChI | InChI=1S/C22H36N2O2/c1-17(2)20-15-22(11-14-26-20,19-9-7-18(3)8-10-19)16-21(25)23-12-6-13-24(4)5/h7-10,17,20H,6,11-16H2,1-5H3,(H,23,25)/p+1/t20-,22+/m0/s1 |
| InChIKey | VPRGUMSCKKEJOK-RBBKRZOGSA-O |
| XLogP | 2.11 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|