C24H38N2O7 — CID 44664777
2-hydroxy-2-oxoacetate;3-[[2-[4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl-dimethylazanium (PubChem CID 44664777) has the molecular formula C24H38N2O7 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;3-[[2-[4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl-dimethylazanium.
| Compound Name | 2-hydroxy-2-oxoacetate;3-[[2-[4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 44664777 |
| Molecular Formula | C24H38N2O7 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;3-[[2-[4-(2-methoxyphenyl)-2-propan-2-yloxan-4-yl]acetyl]amino]propyl-dimethylazanium |
| SMILES | COc1ccccc1C1(CC(=O)NCCC[NH+](C)C)CCOC(C(C)C)C1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C22H36N2O3.C2H2O4/c1-17(2)20-15-22(11-14-27-20,18-9-6-7-10-19(18)26-5)16-21(25)23-12-8-13-24(3)4;3-1(4)2(5)6/h6-7,9-10,17,20H,8,11-16H2,1-5H3,(H,23,25);(H,3,4)(H,5,6) |
| InChIKey | KZHYDQOWBZVMHF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|