C40H50N4O7 — CID 70945161
5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-oxopentanoic acid (PubChem CID 70945161) has the molecular formula C40H50N4O7 and a molecular weight of 698.86 g/mol. Its IUPAC name is 5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-oxopentanoic acid.
| Compound Name | 5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70945161 |
| Molecular Formula | C40H50N4O7 |
| Molecular Weight | 698.86 g/mol |
| Exact Mass | 698.37 |
| IUPAC Name | 5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-4-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-oxopentanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(CCC(=O)O)C(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C40H50N4O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-35(45)41-33(25-28-37(47)48)38(49)42-32-23-21-22-30-31(32)29-44(40(30)51)34-26-27-36(46)43-39(34)50/h3-4,6-7,9-10,12-13,15-16,18-19,21-23,33-34H,2,5,8,11,14,17,20,24-29H2,1H3,(H,41,45)(H,42,49)(H,47,48)(H,43,46,50) |
| InChIKey | SGPSUHYRNAINIZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.86 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|