C38H46N4O6 — CID 70945152
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 70945152) has the molecular formula C38H46N4O6 and a molecular weight of 654.81 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 70945152 |
| Molecular Formula | C38H46N4O6 |
| Molecular Weight | 654.81 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[(2S)-1-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-1-oxopropan-2-yl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N[C@@H](C)C(=O)Nc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C38H46N4O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-32(43)39-28(2)35(45)40-30-24-22-23-29-34(30)38(48)42(37(29)47)31-26-27-33(44)41-36(31)46/h4-5,7-8,10-11,13-14,16-17,19-20,22-24,28,31H,3,6,9,12,15,18,21,25-27H2,1-2H3,(H,39,43)(H,40,45)(H,41,44,46)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-/t28-,31?/m0/s1 |
| InChIKey | ZWIRAIONLINJMR-BHYBJQEOSA-N |
| XLogP | 6.01 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.81 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|