C14H22O5 — CID 70952316
ethyl (3aS,4S,7aS)-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 70952316) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is ethyl (3aS,4S,7aS)-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,7aS)-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 70952316 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | ethyl (3aS,4S,7aS)-2,2-diethyl-4-hydroxy-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(O)C=CC[C@@H]2OC(CC)(CC)O[C@@H]21 |
| InChI | InChI=1S/C14H22O5/c1-4-13(5-2)18-10-8-7-9-14(16,11(10)19-13)12(15)17-6-3/h7,9-11,16H,4-6,8H2,1-3H3/t10-,11-,14-/m0/s1 |
| InChIKey | JBLWFZNRNQVENV-MJVIPROJSA-N |
| XLogP | 1.54 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|