C17H26O6 — CID 70952399
ethyl (3aS,4S,7R,7aS)-4-acetyloxy-2,2-diethyl-7-methyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 70952399) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is ethyl (3aS,4S,7R,7aS)-4-acetyloxy-2,2-diethyl-7-methyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,7R,7aS)-4-acetyloxy-2,2-diethyl-7-methyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 70952399 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | ethyl (3aS,4S,7R,7aS)-4-acetyloxy-2,2-diethyl-7-methyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(OC(C)=O)C=C[C@@H](C)[C@@H]2OC(CC)(CC)O[C@@H]21 |
| InChI | InChI=1S/C17H26O6/c1-6-16(7-2)22-13-11(4)9-10-17(14(13)23-16,21-12(5)18)15(19)20-8-3/h9-11,13-14H,6-8H2,1-5H3/t11-,13+,14+,17+/m1/s1 |
| InChIKey | DQZHMYYRHAKVIH-YSLLHCQFSA-N |
| XLogP | 2.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|