C17H27NO5 — CID 58392613
ethyl (3aR,6S,7R,7aS)-7-acetamido-2,2-diethyl-6-methyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate (PubChem CID 58392613) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is ethyl (3aR,6S,7R,7aS)-7-acetamido-2,2-diethyl-6-methyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aR,6S,7R,7aS)-7-acetamido-2,2-diethyl-6-methyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 58392613 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | ethyl (3aR,6S,7R,7aS)-7-acetamido-2,2-diethyl-6-methyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H](C)[C@@H](NC(C)=O)[C@@H]2OC(CC)(CC)O[C@H]12 |
| InChI | InChI=1S/C17H27NO5/c1-6-17(7-2)22-14-12(16(20)21-8-3)9-10(4)13(15(14)23-17)18-11(5)19/h9-10,13-15H,6-8H2,1-5H3,(H,18,19)/t10-,13+,14+,15-/m0/s1 |
| InChIKey | PWIXTKMUTKRQKU-QOWREQOWSA-N |
| XLogP | 1.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |