C16H23NO7 — CID 44516527
ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate (PubChem CID 44516527) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate.
| Compound Name | ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 44516527 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | ethyl (3aS,4S,7R,7aS)-7-acetamido-4-acetyloxy-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxole-4-carboxylate |
| SMILES | CCOC(=O)[C@]1(OC(C)=O)C=C[C@@H](NC(C)=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C16H23NO7/c1-6-21-14(20)16(22-10(3)19)8-7-11(17-9(2)18)12-13(16)24-15(4,5)23-12/h7-8,11-13H,6H2,1-5H3,(H,17,18)/t11-,12+,13+,16+/m1/s1 |
| InChIKey | NYQVCXLNXCVDJU-DVZHBHJUSA-N |
| XLogP | 0.45 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|