C19H34O4 — CID 70958101
[2-methyl-2-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2,2-dimethylbutanoate (PubChem CID 70958101) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is [2-methyl-2-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2,2-dimethylbutanoate.
| Compound Name | [2-methyl-2-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 70958101 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | [2-methyl-2-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1CCC2OC(C)(CC(C)C)OC2C1 |
| InChI | InChI=1S/C19H34O4/c1-7-18(4,5)17(20)21-12-14-8-9-15-16(10-14)23-19(6,22-15)11-13(2)3/h13-16H,7-12H2,1-6H3 |
| InChIKey | KTFHYMORHDCBJV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |