C18H14N2O3S — CID 70960232
(4-methylphenyl)-(4-pyridazin-3-ylsulfonylphenyl)methanone (PubChem CID 70960232) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is (4-methylphenyl)-(4-pyridazin-3-ylsulfonylphenyl)methanone.
| Compound Name | (4-methylphenyl)-(4-pyridazin-3-ylsulfonylphenyl)methanone |
|---|---|
| PubChem CID | 70960232 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | (4-methylphenyl)-(4-pyridazin-3-ylsulfonylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(S(=O)(=O)c3cccnn3)cc2)cc1 |
| InChI | InChI=1S/C18H14N2O3S/c1-13-4-6-14(7-5-13)18(21)15-8-10-16(11-9-15)24(22,23)17-3-2-12-19-20-17/h2-12H,1H3 |
| InChIKey | LQPQSTNPZDANKV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |