C11H18N6O3 — CID 70960272
(2R,3S)-2-[(1R)-1-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)ethoxy]butane-1,3-diol (PubChem CID 70960272) has the molecular formula C11H18N6O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2R,3S)-2-[(1R)-1-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)ethoxy]butane-1,3-diol.
| Compound Name | (2R,3S)-2-[(1R)-1-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)ethoxy]butane-1,3-diol |
|---|---|
| PubChem CID | 70960272 |
| Molecular Formula | C11H18N6O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2R,3S)-2-[(1R)-1-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)ethoxy]butane-1,3-diol |
| SMILES | C[C@H](O)[C@@H](CO)O[C@H](C)c1cnc2c(N)nc(N)nn12 |
| InChI | InChI=1S/C11H18N6O3/c1-5(19)8(4-18)20-6(2)7-3-14-10-9(12)15-11(13)16-17(7)10/h3,5-6,8,18-19H,4H2,1-2H3,(H4,12,13,15,16)/t5-,6+,8+/m0/s1 |
| InChIKey | UHHONHVSJAATRH-SHYZEUOFSA-N |
| XLogP | -0.89 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|