C19H31N3O3 — CID 70962355
tert-butyl N-[[1-(2-bicyclo[3.3.1]non-3-enylcarbamoyl)azetidin-3-yl]methyl]carbamate (PubChem CID 70962355) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-bicyclo[3.3.1]non-3-enylcarbamoyl)azetidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-(2-bicyclo[3.3.1]non-3-enylcarbamoyl)azetidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 70962355 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | tert-butyl N-[[1-(2-bicyclo[3.3.1]non-3-enylcarbamoyl)azetidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CN(C(=O)NC2C=CC3CCCC2C3)C1 |
| InChI | InChI=1S/C19H31N3O3/c1-19(2,3)25-18(24)20-10-14-11-22(12-14)17(23)21-16-8-7-13-5-4-6-15(16)9-13/h7-8,13-16H,4-6,9-12H2,1-3H3,(H,20,24)(H,21,23) |
| InChIKey | UITSNYPUGNXYSD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|