C22H23NO3 — CID 7096835
(3R)-3-(2,5-dimethylpyrrol-1-yl)-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 7096835) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (3R)-3-(2,5-dimethylpyrrol-1-yl)-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | (3R)-3-(2,5-dimethylpyrrol-1-yl)-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 7096835 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (3R)-3-(2,5-dimethylpyrrol-1-yl)-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | Cc1ccc(C)n1[C@H](CC(=O)O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-16-8-9-17(2)23(16)21(14-22(24)25)19-10-12-20(13-11-19)26-15-18-6-4-3-5-7-18/h3-13,21H,14-15H2,1-2H3,(H,24,25)/t21-/m1/s1 |
| InChIKey | GGWFBFBOFXATQV-OAQYLSRUSA-N |
| XLogP | 4.75 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_N(1)', 'substructure': 'N/A'} |
|---|