C23H18ClN3O4S — CID 70975758
2-(4-chlorophenyl)-N-[4-(4-methylphenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide (PubChem CID 70975758) has the molecular formula C23H18ClN3O4S and a molecular weight of 467.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-(4-methylphenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-(4-methylphenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide |
|---|---|
| PubChem CID | 70975758 |
| Molecular Formula | C23H18ClN3O4S |
| Molecular Weight | 467.93 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-(4-methylphenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)c2nn(NC(=O)Cc3ccc(Cl)cc3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H18ClN3O4S/c1-15-6-12-18(13-7-15)32(30,31)22-19-4-2-3-5-20(19)23(29)27(26-22)25-21(28)14-16-8-10-17(24)11-9-16/h2-13H,14H2,1H3,(H,25,28) |
| InChIKey | UVZSRMWBFLVXAE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.93 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |