C23H15ClN4O4S — CID 70975892
2-(4-chlorophenyl)-N-[4-(4-cyanophenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide (PubChem CID 70975892) has the molecular formula C23H15ClN4O4S and a molecular weight of 478.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-(4-cyanophenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-(4-cyanophenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide |
|---|---|
| PubChem CID | 70975892 |
| Molecular Formula | C23H15ClN4O4S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-(4-cyanophenyl)sulfonyl-1-oxophthalazin-2-yl]acetamide |
| SMILES | N#Cc1ccc(S(=O)(=O)c2nn(NC(=O)Cc3ccc(Cl)cc3)c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H15ClN4O4S/c24-17-9-5-15(6-10-17)13-21(29)26-28-23(30)20-4-2-1-3-19(20)22(27-28)33(31,32)18-11-7-16(14-25)8-12-18/h1-12H,13H2,(H,26,29) |
| InChIKey | CCNIUVSOBMMLKR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |