C20H20ClN3O2S — CID 70976061
N-(4-tert-butylsulfanyl-1-oxophthalazin-2-yl)-2-(4-chlorophenyl)acetamide (PubChem CID 70976061) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is N-(4-tert-butylsulfanyl-1-oxophthalazin-2-yl)-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(4-tert-butylsulfanyl-1-oxophthalazin-2-yl)-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 70976061 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-(4-tert-butylsulfanyl-1-oxophthalazin-2-yl)-2-(4-chlorophenyl)acetamide |
| SMILES | CC(C)(C)Sc1nn(NC(=O)Cc2ccc(Cl)cc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C20H20ClN3O2S/c1-20(2,3)27-18-15-6-4-5-7-16(15)19(26)24(23-18)22-17(25)12-13-8-10-14(21)11-9-13/h4-11H,12H2,1-3H3,(H,22,25) |
| InChIKey | QMIRQOGASVDNPS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |