C24H25ClN4O4 — CID 123960931
cyclohexyl N-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-oxophthalazin-1-yl]methyl]carbamate (PubChem CID 123960931) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is cyclohexyl N-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-oxophthalazin-1-yl]methyl]carbamate.
| Compound Name | cyclohexyl N-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-oxophthalazin-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 123960931 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | cyclohexyl N-[[3-[[2-(4-chlorophenyl)acetyl]amino]-4-oxophthalazin-1-yl]methyl]carbamate |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nn1nc(CNC(=O)OC2CCCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H25ClN4O4/c25-17-12-10-16(11-13-17)14-22(30)28-29-23(31)20-9-5-4-8-19(20)21(27-29)15-26-24(32)33-18-6-2-1-3-7-18/h4-5,8-13,18H,1-3,6-7,14-15H2,(H,26,32)(H,28,30) |
| InChIKey | NBDZVFHKVCDNJP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |