C22H21Cl2N3O3 — CID 90490219
N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 90490219) has the molecular formula C22H21Cl2N3O3 and a molecular weight of 446.33 g/mol. Its IUPAC name is N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 90490219 |
| Molecular Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.33 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[(3-cyclopentyl-4-oxophthalazin-1-yl)methyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCc1nn(C2CCCC2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H21Cl2N3O3/c23-14-9-10-20(18(24)11-14)30-13-21(28)25-12-19-16-7-3-4-8-17(16)22(29)27(26-19)15-5-1-2-6-15/h3-4,7-11,15H,1-2,5-6,12-13H2,(H,25,28) |
| InChIKey | FIPOUZLKPXYUQI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |