C22H17F3N2O4S — CID 70979571
3-pyridin-3-yl-N-[[4-[2-(trifluoromethoxy)phenyl]sulfonylphenyl]methyl]prop-2-enamide (PubChem CID 70979571) has the molecular formula C22H17F3N2O4S and a molecular weight of 462.45 g/mol. Its IUPAC name is 3-pyridin-3-yl-N-[[4-[2-(trifluoromethoxy)phenyl]sulfonylphenyl]methyl]prop-2-enamide.
| Compound Name | 3-pyridin-3-yl-N-[[4-[2-(trifluoromethoxy)phenyl]sulfonylphenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 70979571 |
| Molecular Formula | C22H17F3N2O4S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 3-pyridin-3-yl-N-[[4-[2-(trifluoromethoxy)phenyl]sulfonylphenyl]methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccnc1)NCc1ccc(S(=O)(=O)c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H17F3N2O4S/c23-22(24,25)31-19-5-1-2-6-20(19)32(29,30)18-10-7-17(8-11-18)15-27-21(28)12-9-16-4-3-13-26-14-16/h1-14H,15H2,(H,27,28) |
| InChIKey | MLKGNDDACYPVLU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|