C24H28BN4O3 — CID 70986612
CID 70986612 (PubChem CID 70986612) has the molecular formula C24H28BN4O3 and a molecular weight of 431.33 g/mol.
| Compound Name | CID 70986612 |
|---|---|
| PubChem CID | 70986612 |
| Molecular Formula | C24H28BN4O3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(COc2cnn(CCc3ccc4c(c3)CN(CCO)CC4)c(=O)c2)nc1 |
| InChI | InChI=1S/C24H28BN4O3/c1-25-21-4-5-22(26-14-21)17-32-23-13-24(31)29(27-15-23)9-6-18-2-3-19-7-8-28(10-11-30)16-20(19)12-18/h2-5,12-15,30H,6-11,16-17H2,1H3 |
| InChIKey | IMQRMHXSKABRGN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|