C21H32FNO3 — CID 70997086
(2R,3R,11bR)-3-(4-fluoro-2,2-dimethylbutyl)-9,10-bis(hydroxymethyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol (PubChem CID 70997086) has the molecular formula C21H32FNO3 and a molecular weight of 365.49 g/mol. Its IUPAC name is (2R,3R,11bR)-3-(4-fluoro-2,2-dimethylbutyl)-9,10-bis(hydroxymethyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol.
| Compound Name | (2R,3R,11bR)-3-(4-fluoro-2,2-dimethylbutyl)-9,10-bis(hydroxymethyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|---|
| PubChem CID | 70997086 |
| Molecular Formula | C21H32FNO3 |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (2R,3R,11bR)-3-(4-fluoro-2,2-dimethylbutyl)-9,10-bis(hydroxymethyl)-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
| SMILES | CC(C)(CCF)C[C@@H]1CN2CCc3cc(CO)c(CO)cc3[C@H]2C[C@H]1O |
| InChI | InChI=1S/C21H32FNO3/c1-21(2,4-5-22)10-17-11-23-6-3-14-7-15(12-24)16(13-25)8-18(14)19(23)9-20(17)26/h7-8,17,19-20,24-26H,3-6,9-13H2,1-2H3/t17-,19-,20-/m1/s1 |
| InChIKey | PJKIAKQBAYJPBF-MISYRCLQSA-N |
| XLogP | 2.73 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |