C22H21I — CID 70999804
(9aR)-7-iodo-9,9,9a-trimethyl-2-phenyl-4aH-fluorene (PubChem CID 70999804) has the molecular formula C22H21I and a molecular weight of 412.31 g/mol. Its IUPAC name is (9aR)-7-iodo-9,9,9a-trimethyl-2-phenyl-4aH-fluorene.
| Compound Name | (9aR)-7-iodo-9,9,9a-trimethyl-2-phenyl-4aH-fluorene |
|---|---|
| PubChem CID | 70999804 |
| Molecular Formula | C22H21I |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (9aR)-7-iodo-9,9,9a-trimethyl-2-phenyl-4aH-fluorene |
| SMILES | CC1(C)c2cc(I)ccc2C2C=CC(c3ccccc3)=C[C@]21C |
| InChI | InChI=1S/C22H21I/c1-21(2)20-13-17(23)10-11-18(20)19-12-9-16(14-22(19,21)3)15-7-5-4-6-8-15/h4-14,19H,1-3H3/t19?,22-/m1/s1 |
| InChIKey | CVGVREPURCZVDQ-AVKWCDSFSA-N |
| XLogP | 6.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|