C26H43N5O6 — CID 71004095
(2S)-2-[[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-4-oxobutyl]-methylamino]-3-methyl-N-[(3S)-2-methyl-4-oxopentan-3-yl]butanamide (PubChem CID 71004095) has the molecular formula C26H43N5O6 and a molecular weight of 521.66 g/mol. Its IUPAC name is (2S)-2-[[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-4-oxobutyl]-methylamino]-3-methyl-N-[(3S)-2-methyl-4-oxopentan-3-yl]butanamide.
| Compound Name | (2S)-2-[[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-4-oxobutyl]-methylamino]-3-methyl-N-[(3S)-2-methyl-4-oxopentan-3-yl]butanamide |
|---|---|
| PubChem CID | 71004095 |
| Molecular Formula | C26H43N5O6 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | (2S)-2-[[4-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoyl]hydrazinyl]-4-oxobutyl]-methylamino]-3-methyl-N-[(3S)-2-methyl-4-oxopentan-3-yl]butanamide |
| SMILES | CC(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)CCCC(=O)NNC(=O)CCCCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C26H43N5O6/c1-17(2)24(19(5)32)27-26(37)25(18(3)4)30(6)15-10-12-21(34)29-28-20(33)11-8-7-9-16-31-22(35)13-14-23(31)36/h13-14,17-18,24-25H,7-12,15-16H2,1-6H3,(H,27,37)(H,28,33)(H,29,34)/t24-,25-/m0/s1 |
| InChIKey | UAXJWMSSARGGJB-DQEYMECFSA-N |
| XLogP | 1.09 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|