C19H28N2 — CID 71016257
(2R,7S)-2,7-dimethyl-6-propyl-6,11-diazatricyclo[7.6.1.012,16]hexadeca-1(16),9,12,14-tetraene (PubChem CID 71016257) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (2R,7S)-2,7-dimethyl-6-propyl-6,11-diazatricyclo[7.6.1.012,16]hexadeca-1(16),9,12,14-tetraene.
| Compound Name | (2R,7S)-2,7-dimethyl-6-propyl-6,11-diazatricyclo[7.6.1.012,16]hexadeca-1(16),9,12,14-tetraene |
|---|---|
| PubChem CID | 71016257 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (2R,7S)-2,7-dimethyl-6-propyl-6,11-diazatricyclo[7.6.1.012,16]hexadeca-1(16),9,12,14-tetraene |
| SMILES | CCCN1CCC[C@@H](C)c2cccc3[nH]cc(c23)C[C@@H]1C |
| InChI | InChI=1S/C19H28N2/c1-4-10-21-11-6-7-14(2)17-8-5-9-18-19(17)16(13-20-18)12-15(21)3/h5,8-9,13-15,20H,4,6-7,10-12H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | ZDGGWQYPEQOYBB-CABCVRRESA-N |
| XLogP | 4.71 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |