C17H23N — CID 71016251
(4R)-5-butyl-4-ethyl-1,3,4,5-tetrahydrobenzo[cd]indole (PubChem CID 71016251) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (4R)-5-butyl-4-ethyl-1,3,4,5-tetrahydrobenzo[cd]indole.
| Compound Name | (4R)-5-butyl-4-ethyl-1,3,4,5-tetrahydrobenzo[cd]indole |
|---|---|
| PubChem CID | 71016251 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (4R)-5-butyl-4-ethyl-1,3,4,5-tetrahydrobenzo[cd]indole |
| SMILES | CCCCC1c2cccc3[nH]cc(c23)C[C@H]1CC |
| InChI | InChI=1S/C17H23N/c1-3-5-7-14-12(4-2)10-13-11-18-16-9-6-8-15(14)17(13)16/h6,8-9,11-12,14,18H,3-5,7,10H2,1-2H3/t12-,14?/m1/s1 |
| InChIKey | JMTDSUCBLIBPEM-PUODRLBUSA-N |
| XLogP | 5.02 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |