C19H25N — CID 142489197
(5E)-4-butyl-5-butylidene-3,4-dihydro-1H-benzo[cd]indole (PubChem CID 142489197) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (5E)-4-butyl-5-butylidene-3,4-dihydro-1H-benzo[cd]indole.
| Compound Name | (5E)-4-butyl-5-butylidene-3,4-dihydro-1H-benzo[cd]indole |
|---|---|
| PubChem CID | 142489197 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (5E)-4-butyl-5-butylidene-3,4-dihydro-1H-benzo[cd]indole |
| SMILES | CCC/C=C1/c2cccc3[nH]cc(c23)CC1CCCC |
| InChI | InChI=1S/C19H25N/c1-3-5-8-14-12-15-13-20-18-11-7-10-17(19(15)18)16(14)9-6-4-2/h7,9-11,13-14,20H,3-6,8,12H2,1-2H3/b16-9+ |
| InChIKey | QKCKWJUUMMICPU-CXUHLZMHSA-N |
| XLogP | 5.71 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |