C20H27N — CID 89200286
(4R)-5-[(2S)-2-ethylbut-3-enyl]-4-propyl-1,3,4,5-tetrahydrobenzo[cd]indole (PubChem CID 89200286) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is (4R)-5-[(2S)-2-ethylbut-3-enyl]-4-propyl-1,3,4,5-tetrahydrobenzo[cd]indole.
| Compound Name | (4R)-5-[(2S)-2-ethylbut-3-enyl]-4-propyl-1,3,4,5-tetrahydrobenzo[cd]indole |
|---|---|
| PubChem CID | 89200286 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (4R)-5-[(2S)-2-ethylbut-3-enyl]-4-propyl-1,3,4,5-tetrahydrobenzo[cd]indole |
| SMILES | C=C[C@@H](CC)CC1c2cccc3[nH]cc(c23)C[C@H]1CCC |
| InChI | InChI=1S/C20H27N/c1-4-8-15-12-16-13-21-19-10-7-9-17(20(16)19)18(15)11-14(5-2)6-3/h5,7,9-10,13-15,18,21H,2,4,6,8,11-12H2,1,3H3/t14-,15+,18?/m0/s1 |
| InChIKey | DRIOOSXSUYNLPK-DYNVDGSKSA-N |
| XLogP | 5.83 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|