C19H25N3O — CID 67875584
(6aR,10aR)-9-butyl-6,6a,7,8,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 67875584) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (6aR,10aR)-9-butyl-6,6a,7,8,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR,10aR)-9-butyl-6,6a,7,8,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 67875584 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (6aR,10aR)-9-butyl-6,6a,7,8,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CCCCC1(C(N)=O)CN[C@@H]2Cc3c[nH]c4cccc(c34)[C@H]2C1 |
| InChI | InChI=1S/C19H25N3O/c1-2-3-7-19(18(20)23)9-14-13-5-4-6-15-17(13)12(10-21-15)8-16(14)22-11-19/h4-6,10,14,16,21-22H,2-3,7-9,11H2,1H3,(H2,20,23)/t14-,16-,19?/m1/s1 |
| InChIKey | JITRLUUWVKYAOI-YVEJMYDXSA-N |
| XLogP | 2.83 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |