C17H30N2O2 — CID 71018306
4-amino-N-butyl-2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-(hydroxymethyl)butanamide (PubChem CID 71018306) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-amino-N-butyl-2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-(hydroxymethyl)butanamide.
| Compound Name | 4-amino-N-butyl-2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-(hydroxymethyl)butanamide |
|---|---|
| PubChem CID | 71018306 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 4-amino-N-butyl-2-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-N-(hydroxymethyl)butanamide |
| SMILES | CCCCN(CO)C(=O)C(CCN)C1=C(C)C=CCC1C |
| InChI | InChI=1S/C17H30N2O2/c1-4-5-11-19(12-20)17(21)15(9-10-18)16-13(2)7-6-8-14(16)3/h6-7,14-15,20H,4-5,8-12,18H2,1-3H3 |
| InChIKey | XKFDNHVDUXKWFG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|