C21H21NO4 — CID 71023762
benzyl 2-acetyl-6-(dimethylamino)-3-oxo-1,2-dihydroindene-5-carboxylate (PubChem CID 71023762) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is benzyl 2-acetyl-6-(dimethylamino)-3-oxo-1,2-dihydroindene-5-carboxylate.
| Compound Name | benzyl 2-acetyl-6-(dimethylamino)-3-oxo-1,2-dihydroindene-5-carboxylate |
|---|---|
| PubChem CID | 71023762 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | benzyl 2-acetyl-6-(dimethylamino)-3-oxo-1,2-dihydroindene-5-carboxylate |
| SMILES | CC(=O)C1Cc2cc(N(C)C)c(C(=O)OCc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C21H21NO4/c1-13(23)16-9-15-10-19(22(2)3)18(11-17(15)20(16)24)21(25)26-12-14-7-5-4-6-8-14/h4-8,10-11,16H,9,12H2,1-3H3 |
| InChIKey | DYFKNEACHJYRDH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|