C33H28O8 — CID 138514198
tribenzyl 6-hydroxy-5-(oxiran-2-ylmethyl)benzene-1,2,4-tricarboxylate (PubChem CID 138514198) has the molecular formula C33H28O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is tribenzyl 6-hydroxy-5-(oxiran-2-ylmethyl)benzene-1,2,4-tricarboxylate.
| Compound Name | tribenzyl 6-hydroxy-5-(oxiran-2-ylmethyl)benzene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 138514198 |
| Molecular Formula | C33H28O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | tribenzyl 6-hydroxy-5-(oxiran-2-ylmethyl)benzene-1,2,4-tricarboxylate |
| SMILES | O=C(OCc1ccccc1)c1cc(C(=O)OCc2ccccc2)c(C(=O)OCc2ccccc2)c(O)c1CC1CO1 |
| InChI | InChI=1S/C33H28O8/c34-30-26(16-25-21-38-25)27(31(35)39-18-22-10-4-1-5-11-22)17-28(32(36)40-19-23-12-6-2-7-13-23)29(30)33(37)41-20-24-14-8-3-9-15-24/h1-15,17,25,34H,16,18-21H2 |
| InChIKey | UONUOWDGZHFRTF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|