C42H34O8 — CID 134267147
benzyl 3-(oxiran-2-ylmethoxy)-4-[2-(oxiran-2-ylmethoxy)-3-phenylmethoxycarbonylnaphthalen-1-yl]naphthalene-2-carboxylate (PubChem CID 134267147) has the molecular formula C42H34O8 and a molecular weight of 666.73 g/mol. Its IUPAC name is benzyl 3-(oxiran-2-ylmethoxy)-4-[2-(oxiran-2-ylmethoxy)-3-phenylmethoxycarbonylnaphthalen-1-yl]naphthalene-2-carboxylate.
| Compound Name | benzyl 3-(oxiran-2-ylmethoxy)-4-[2-(oxiran-2-ylmethoxy)-3-phenylmethoxycarbonylnaphthalen-1-yl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 134267147 |
| Molecular Formula | C42H34O8 |
| Molecular Weight | 666.73 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | benzyl 3-(oxiran-2-ylmethoxy)-4-[2-(oxiran-2-ylmethoxy)-3-phenylmethoxycarbonylnaphthalen-1-yl]naphthalene-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1cc2ccccc2c(-c2c(OCC3CO3)c(C(=O)OCc3ccccc3)cc3ccccc23)c1OCC1CO1 |
| InChI | InChI=1S/C42H34O8/c43-41(49-21-27-11-3-1-4-12-27)35-19-29-15-7-9-17-33(29)37(39(35)47-25-31-23-45-31)38-34-18-10-8-16-30(34)20-36(40(38)48-26-32-24-46-32)42(44)50-22-28-13-5-2-6-14-28/h1-20,31-32H,21-26H2 |
| InChIKey | DSWATJFNRJQKDR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 96.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.73 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|