C28H39F3N3O5P — CID 71035624
benzyl-[(1S,4S,6R,14S)-2,15-dioxo-14-(4,4,4-trifluorobutanoylamino)-3,16-diazatricyclo[14.3.0.04,6]nonadecan-4-yl]phosphinic acid (PubChem CID 71035624) has the molecular formula C28H39F3N3O5P and a molecular weight of 585.60 g/mol. Its IUPAC name is benzyl-[(1S,4S,6R,14S)-2,15-dioxo-14-(4,4,4-trifluorobutanoylamino)-3,16-diazatricyclo[14.3.0.04,6]nonadecan-4-yl]phosphinic acid.
| Compound Name | benzyl-[(1S,4S,6R,14S)-2,15-dioxo-14-(4,4,4-trifluorobutanoylamino)-3,16-diazatricyclo[14.3.0.04,6]nonadecan-4-yl]phosphinic acid |
|---|---|
| PubChem CID | 71035624 |
| Molecular Formula | C28H39F3N3O5P |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | benzyl-[(1S,4S,6R,14S)-2,15-dioxo-14-(4,4,4-trifluorobutanoylamino)-3,16-diazatricyclo[14.3.0.04,6]nonadecan-4-yl]phosphinic acid |
| SMILES | O=C(CCC(F)(F)F)N[C@H]1CCCCCCC[C@@H]2C[C@@]2(P(=O)(O)Cc2ccccc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C28H39F3N3O5P/c29-28(30,31)16-15-24(35)32-22-13-8-3-1-2-7-12-21-18-27(21,40(38,39)19-20-10-5-4-6-11-20)33-25(36)23-14-9-17-34(23)26(22)37/h4-6,10-11,21-23H,1-3,7-9,12-19H2,(H,32,35)(H,33,36)(H,38,39)/t21-,22+,23+,27+/m1/s1 |
| InChIKey | MSGHMVHZZNCDJB-GGLGADRISA-N |
| XLogP | 4.85 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|