C30H43N4O5P — CID 71035851
benzyl-[(1S,4S,6S,7Z,14S)-14-(cyclopentylcarbamoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]phosphinic acid (PubChem CID 71035851) has the molecular formula C30H43N4O5P and a molecular weight of 570.67 g/mol. Its IUPAC name is benzyl-[(1S,4S,6S,7Z,14S)-14-(cyclopentylcarbamoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]phosphinic acid.
| Compound Name | benzyl-[(1S,4S,6S,7Z,14S)-14-(cyclopentylcarbamoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]phosphinic acid |
|---|---|
| PubChem CID | 71035851 |
| Molecular Formula | C30H43N4O5P |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | benzyl-[(1S,4S,6S,7Z,14S)-14-(cyclopentylcarbamoylamino)-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-en-4-yl]phosphinic acid |
| SMILES | O=C(NC1CCCC1)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(P(=O)(O)Cc2ccccc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C30H43N4O5P/c35-27-26-18-11-19-34(26)28(36)25(32-29(37)31-24-15-9-10-16-24)17-8-3-1-2-7-14-23-20-30(23,33-27)40(38,39)21-22-12-5-4-6-13-22/h4-7,12-14,23-26H,1-3,8-11,15-21H2,(H,33,35)(H,38,39)(H2,31,32,37)/b14-7-/t23-,25+,26+,30+/m1/s1 |
| InChIKey | KNPNDWXHYLPXGV-AMYJACONSA-N |
| XLogP | 4.41 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|