C12H26BNO — CID 71037603
2,5-bis(2,2-dimethylpropyl)-1,3,2-oxazaborolidine (PubChem CID 71037603) has the molecular formula C12H26BNO and a molecular weight of 211.16 g/mol. Its IUPAC name is 2,5-bis(2,2-dimethylpropyl)-1,3,2-oxazaborolidine.
| Compound Name | 2,5-bis(2,2-dimethylpropyl)-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 71037603 |
| Molecular Formula | C12H26BNO |
| Molecular Weight | 211.16 g/mol |
| Exact Mass | 211.21 |
| IUPAC Name | 2,5-bis(2,2-dimethylpropyl)-1,3,2-oxazaborolidine |
| SMILES | CC(C)(C)CB1NCC(CC(C)(C)C)O1 |
| InChI | InChI=1S/C12H26BNO/c1-11(2,3)7-10-8-14-13(15-10)9-12(4,5)6/h10,14H,7-9H2,1-6H3 |
| InChIKey | LDIPRUSXESIROU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|