C26H31FNO3P — CID 71040133
2-[1-(3,5-dimethoxy-2-phenylmethoxyphenyl)propylphosphanyl]-5-fluoro-N,N-dimethylaniline (PubChem CID 71040133) has the molecular formula C26H31FNO3P and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-[1-(3,5-dimethoxy-2-phenylmethoxyphenyl)propylphosphanyl]-5-fluoro-N,N-dimethylaniline.
| Compound Name | 2-[1-(3,5-dimethoxy-2-phenylmethoxyphenyl)propylphosphanyl]-5-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 71040133 |
| Molecular Formula | C26H31FNO3P |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-[1-(3,5-dimethoxy-2-phenylmethoxyphenyl)propylphosphanyl]-5-fluoro-N,N-dimethylaniline |
| SMILES | CCC(Pc1ccc(F)cc1N(C)C)c1cc(OC)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H31FNO3P/c1-6-24(32-25-13-12-19(27)14-22(25)28(2)3)21-15-20(29-4)16-23(30-5)26(21)31-17-18-10-8-7-9-11-18/h7-16,24,32H,6,17H2,1-5H3 |
| InChIKey | LHGUSZPOIQGYDG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|