C29H35N5O3 — CID 71049697
(16E)-3-methyl-10-(2-morpholin-4-ylethoxy)-14-oxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene (PubChem CID 71049697) has the molecular formula C29H35N5O3 and a molecular weight of 501.63 g/mol. Its IUPAC name is (16E)-3-methyl-10-(2-morpholin-4-ylethoxy)-14-oxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene.
| Compound Name | (16E)-3-methyl-10-(2-morpholin-4-ylethoxy)-14-oxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
|---|---|
| PubChem CID | 71049697 |
| Molecular Formula | C29H35N5O3 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (16E)-3-methyl-10-(2-morpholin-4-ylethoxy)-14-oxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8,10,12(26),16,21,23-decaene |
| SMILES | Cc1cnc2nc1-c1ccnc(c1)CCC/C=C/COCc1cc(cc(OCCN3CCOCC3)c1)N2 |
| InChI | InChI=1S/C29H35N5O3/c1-22-20-31-29-32-26-16-23(17-27(19-26)37-15-11-34-9-13-35-14-10-34)21-36-12-5-3-2-4-6-25-18-24(7-8-30-25)28(22)33-29/h3,5,7-8,16-20H,2,4,6,9-15,21H2,1H3,(H,31,32,33)/b5-3+ |
| InChIKey | FXYUVZDCANIXNU-HWKANZROSA-N |
| XLogP | 4.71 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|