C24H42N5O8PS — CID 71058335
[3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-decan-2-yloxy-3-methylsulfanylpropyl) hydrogen phosphate (PubChem CID 71058335) has the molecular formula C24H42N5O8PS and a molecular weight of 591.67 g/mol. Its IUPAC name is [3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-decan-2-yloxy-3-methylsulfanylpropyl) hydrogen phosphate.
| Compound Name | [3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-decan-2-yloxy-3-methylsulfanylpropyl) hydrogen phosphate |
|---|---|
| PubChem CID | 71058335 |
| Molecular Formula | C24H42N5O8PS |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | [3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl (2-decan-2-yloxy-3-methylsulfanylpropyl) hydrogen phosphate |
| SMILES | CCCCCCCCC(C)OC(COP(=O)(O)OCC1OC(n2cc(C)c(=O)[nH]c2=O)CC1N=[N+]=[N-])CSC |
| InChI | InChI=1S/C24H42N5O8PS/c1-5-6-7-8-9-10-11-18(3)36-19(16-39-4)14-34-38(32,33)35-15-21-20(27-28-25)12-22(37-21)29-13-17(2)23(30)26-24(29)31/h13,18-22H,5-12,14-16H2,1-4H3,(H,32,33)(H,26,30,31) |
| InChIKey | MZHJCIVOHAHHMI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 177.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|