C25H45N2O9PS — CID 71054445
(2-decan-2-yloxy-3-ethylsulfanylpropyl) [3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 71054445) has the molecular formula C25H45N2O9PS and a molecular weight of 580.68 g/mol. Its IUPAC name is (2-decan-2-yloxy-3-ethylsulfanylpropyl) [3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | (2-decan-2-yloxy-3-ethylsulfanylpropyl) [3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 71054445 |
| Molecular Formula | C25H45N2O9PS |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | (2-decan-2-yloxy-3-ethylsulfanylpropyl) [3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CCCCCCCCC(C)OC(COP(=O)(O)OCC1OC(n2cc(C)c(=O)[nH]c2=O)CC1O)CSCC |
| InChI | InChI=1S/C25H45N2O9PS/c1-5-7-8-9-10-11-12-19(4)35-20(17-38-6-2)15-33-37(31,32)34-16-22-21(28)13-23(36-22)27-14-18(3)24(29)26-25(27)30/h14,19-23,28H,5-13,15-17H2,1-4H3,(H,31,32)(H,26,29,30) |
| InChIKey | VEMJYFRLSYQGOM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|