C34H34N6O5 — CID 71062413
3-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-(5-butyl-3-ethoxycarbonyl-1-phenylpyrazol-4-yl)benzoic acid (PubChem CID 71062413) has the molecular formula C34H34N6O5 and a molecular weight of 606.68 g/mol. Its IUPAC name is 3-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-(5-butyl-3-ethoxycarbonyl-1-phenylpyrazol-4-yl)benzoic acid.
| Compound Name | 3-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-(5-butyl-3-ethoxycarbonyl-1-phenylpyrazol-4-yl)benzoic acid |
|---|---|
| PubChem CID | 71062413 |
| Molecular Formula | C34H34N6O5 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | 3-[3-(azidomethyl)-3,4-dihydro-1H-isoquinoline-2-carbonyl]-5-(5-butyl-3-ethoxycarbonyl-1-phenylpyrazol-4-yl)benzoic acid |
| SMILES | CCCCc1c(-c2cc(C(=O)O)cc(C(=O)N3Cc4ccccc4CC3CN=[N+]=[N-])c2)c(C(=O)OCC)nn1-c1ccccc1 |
| InChI | InChI=1S/C34H34N6O5/c1-3-5-15-29-30(31(34(44)45-4-2)37-40(29)27-13-7-6-8-14-27)24-16-25(18-26(17-24)33(42)43)32(41)39-21-23-12-10-9-11-22(23)19-28(39)20-36-38-35/h6-14,16-18,28H,3-5,15,19-21H2,1-2H3,(H,42,43) |
| InChIKey | ZMSVIKILMATQPE-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|